Difference between revisions of "2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15172 == * common-name: ** 6,7-dehydrobaicalein * molecular-weight: ** 268.225 * inchi-key: ** lsqwciyrgvwpfx-uhfffaoysa-n * smiles:...")
 
(Created page with "Category:metabolite == Metabolite 2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE == * common-name: ** (2r,3s)-3-isopropylmalate * molecular-weight: ** 174.153 * inchi-key: ** rnq...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-15172 ==
+
== Metabolite 2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE ==
 
* common-name:
 
* common-name:
−
** 6,7-dehydrobaicalein
+
** (2r,3s)-3-isopropylmalate
 
* molecular-weight:
 
* molecular-weight:
−
** 268.225
+
** 174.153
 
* inchi-key:
 
* inchi-key:
−
** lsqwciyrgvwpfx-uhfffaoysa-n
+
** rnqhmtfbussbjq-crclsjgqsa-l
 
* smiles:
 
* smiles:
−
** c1(c=cc(=cc=1)c2(=cc(=o)c3(c(o2)=cc(=o)c(=o)c(o)=3)))
+
** cc(c)c(c([o-])=o)c(c([o-])=o)o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3-ISOPROPYLMALDEHYDROG-RXN]]
 +
* [[RXN-13158]]
 +
* [[RXN-13163]]
 +
* [[RXN-8991]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-14240]]
+
* [[RXN-13163]]
 +
* [[RXN-8991]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=6,7-dehydrobaicalein}}
+
{{#set: common-name=(2r,3s)-3-isopropylmalate}}
−
{{#set: molecular-weight=268.225}}
+
{{#set: molecular-weight=174.153}}
−
{{#set: inchi-key=inchikey=lsqwciyrgvwpfx-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=rnqhmtfbussbjq-crclsjgqsa-l}}

Latest revision as of 19:34, 17 March 2021

Metabolite 2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE

  • common-name:
    • (2r,3s)-3-isopropylmalate
  • molecular-weight:
    • 174.153
  • inchi-key:
    • rnqhmtfbussbjq-crclsjgqsa-l
  • smiles:
    • cc(c)c(c([o-])=o)c(c([o-])=o)o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE&oldid=48890"