Difference between revisions of "2-DEHYDROPANTOATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SHIKIMATE == * common-name: ** shikimate * molecular-weight: ** 173.145 * inchi-key: ** jxohggnkmltubp-hsuxutppsa-m * smiles: ** c1(=c(cc...") |
(Created page with "Category:metabolite == Metabolite 7-AMINOMETHYL-7-DEAZAGUANINE == * common-name: ** preq1 * molecular-weight: ** 180.189 * inchi-key: ** meymblgokydglz-uhfffaoysa-o * smil...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 7-AMINOMETHYL-7-DEAZAGUANINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** preq1 |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 180.189 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** meymblgokydglz-uhfffaoysa-o |
* smiles: | * smiles: | ||
| − | ** | + | ** c([n+])c2(c1(c(=o)nc(n)=nc=1nc=2)) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-1321]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=preq1}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=180.189}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=meymblgokydglz-uhfffaoysa-o}} |
Revision as of 17:54, 13 January 2021
Contents
Metabolite 7-AMINOMETHYL-7-DEAZAGUANINE
- common-name:
- preq1
- molecular-weight:
- 180.189
- inchi-key:
- meymblgokydglz-uhfffaoysa-o
- smiles:
- c([n+])c2(c1(c(=o)nc(n)=nc=1nc=2))
