Difference between revisions of "2-DEOXYRIBOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8121 == * common-name: ** icosatetraenoate * molecular-weight: ** 303.464 * inchi-key: ** hqpcsdadvlfhho-ltkcoykysa-m * smiles: ** cc...")
(Created page with "Category:metabolite == Metabolite 2-DEOXYRIBOSE == * common-name: ** 2'-deoxyribose * molecular-weight: ** 134.132 * inchi-key: ** asjsaqirzkanqn-crclsjgqsa-n * smiles: **...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8121 ==
+
== Metabolite 2-DEOXYRIBOSE ==
 
* common-name:
 
* common-name:
** icosatetraenoate
+
** 2'-deoxyribose
 
* molecular-weight:
 
* molecular-weight:
** 303.464
+
** 134.132
 
* inchi-key:
 
* inchi-key:
** hqpcsdadvlfhho-ltkcoykysa-m
+
** asjsaqirzkanqn-crclsjgqsa-n
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccc=cccccccc([o-])=o
+
** c(o)c(o)c(o)c[ch]=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8349_PLANTCYC]]
+
* [[RXN-14223]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8349_PLANTCYC]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=icosatetraenoate}}
+
{{#set: common-name=2'-deoxyribose}}
{{#set: molecular-weight=303.464}}
+
{{#set: molecular-weight=134.132}}
{{#set: inchi-key=inchikey=hqpcsdadvlfhho-ltkcoykysa-m}}
+
{{#set: inchi-key=inchikey=asjsaqirzkanqn-crclsjgqsa-n}}

Latest revision as of 19:37, 17 March 2021

Metabolite 2-DEOXYRIBOSE

  • common-name:
    • 2'-deoxyribose
  • molecular-weight:
    • 134.132
  • inchi-key:
    • asjsaqirzkanqn-crclsjgqsa-n
  • smiles:
    • c(o)c(o)c(o)c[ch]=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality