Difference between revisions of "2-Hydroxy-carboxylates"

Revision as of 19:04, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-15667 ==
+== Metabolite PHOSPHATIDYLCHOLINE ==
 * common-name:
-** 6-cis, 3-oxo-tridecenoyl-coa
+** a phosphatidylcholine
-* molecular-weight:
-** 971.802
-* inchi-key:
-** fdxhxlpclxeysu-dxazuofzsa-j
-* smiles:
-** ccccccc=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 == Reaction(s) known to consume the compound ==
-* [[RXN-14774]]
+* [[2.3.1.23-RXN]]
+* [[RXN-1501_METACYC18.5]]
+* [[RXN-1641]]
 == Reaction(s) known to produce the compound ==
+* [[2.3.1.23-RXN]]
+* [[2.7.8.24-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=6-cis, 3-oxo-tridecenoyl-coa}}
+{{#set: common-name=a phosphatidylcholine}}
-{{#set: molecular-weight=971.802}}
-{{#set: inchi-key=inchikey=fdxhxlpclxeysu-dxazuofzsa-j}}