Difference between revisions of "2-KETO-ISOVALERATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-5661 == * common-name: ** zeinoxanthin * molecular-weight: ** 552.882 * inchi-key: ** nbzanzvjrkxvbh-nhwxejklsa-n * smiles: ** cc(c=c...")
(Created page with "Category:metabolite == Metabolite 2-Me-Branched-234-Sat-Fatty-Acyl-CoA == * common-name: ** a 2-methyl branched 2,3,4-saturated fatty acyl-coa == Reaction(s) known to cons...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-5661 ==
+
== Metabolite 2-Me-Branched-234-Sat-Fatty-Acyl-CoA ==
 
* common-name:
 
* common-name:
** zeinoxanthin
+
** a 2-methyl branched 2,3,4-saturated fatty acyl-coa
* molecular-weight:
 
** 552.882
 
* inchi-key:
 
** nbzanzvjrkxvbh-nhwxejklsa-n
 
* smiles:
 
** cc(c=cc=c(c)c=cc1(c(c)(c)ccc=c(c)1))=cc=cc=c(c)c=cc=c(c)c=cc2(c(c)(c)cc(o)cc(c)=2)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-5962]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN66-483]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=zeinoxanthin}}
+
{{#set: common-name=a 2-methyl branched 2,3,4-saturated fatty acyl-coa}}
{{#set: molecular-weight=552.882}}
 
{{#set: inchi-key=inchikey=nbzanzvjrkxvbh-nhwxejklsa-n}}
 

Revision as of 15:12, 15 March 2021

Metabolite 2-Me-Branched-234-Sat-Fatty-Acyl-CoA

  • common-name:
    • a 2-methyl branched 2,3,4-saturated fatty acyl-coa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality