Difference between revisions of "2-KETOGLUTARATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DOPAQUINONE == * common-name: ** dopaquinone * molecular-weight: ** 195.174 * inchi-key: ** ahmiduvksgchau-lurjtmiesa-n * smiles: ** c([o...")
(Created page with "Category:metabolite == Metabolite 2-KETOGLUTARATE == * common-name: ** 2-oxoglutarate * molecular-weight: ** 144.084 * inchi-key: ** kpgxrsrhynqifn-uhfffaoysa-l * smiles:...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite DOPAQUINONE ==
+
== Metabolite 2-KETOGLUTARATE ==
 
* common-name:
 
* common-name:
−
** dopaquinone
+
** 2-oxoglutarate
 
* molecular-weight:
 
* molecular-weight:
−
** 195.174
+
** 144.084
 
* inchi-key:
 
* inchi-key:
−
** ahmiduvksgchau-lurjtmiesa-n
+
** kpgxrsrhynqifn-uhfffaoysa-l
 
* smiles:
 
* smiles:
−
** c([o-])(=o)c([n+])cc1(=cc(=o)c(=o)c=c1)
+
** c(cc([o-])=o)c(=o)c([o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-11369]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
* [[RXN-8483]]
+
* [[1.14.11.2-RXN]]
 +
* [[2.5.1.64-RXN]]
 +
* [[2.6.1.22-RXN]]
 +
* [[2.6.1.57-RXN]]
 +
* [[2.6.1.7-RXN]]
 +
* [[2OXOGLUTDECARB-RXN]]
 +
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
 +
* [[ACETYLORNTRANSAM-RXN]]
 +
* [[ALANINE-AMINOTRANSFERASE-RXN]]
 +
* [[ASPAMINOTRANS-RXN]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]]
 +
* [[CYSTEINE-AMINOTRANSFERASE-RXN]]
 +
* [[DIAMTRANSAM-RXN]]
 +
* [[GLUTAMATE-DEHYDROGENASE-NADP+-RXN]]
 +
* [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
 +
* [[GLUTAMATE-SYNTHASE-NADH-RXN]]
 +
* [[GLUTAMATESYN-RXN]]
 +
* [[GLUTDEHYD-RXN]]
 +
* [[GLYCINE-AMINOTRANSFERASE-RXN]]
 +
* [[HISTAMINOTRANS-RXN]]
 +
* [[ISOCITDEH-RXN]]
 +
* [[NARINGENIN-3-DIOXYGENASE-RXN]]
 +
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 +
* [[PEPTIDE-ASPARTATE-BETA-DIOXYGENASE-RXN]]
 +
* [[PHEAMINOTRANS-RXN]]
 +
* [[PREPHENATE-TRANSAMINE-RXN]]
 +
* [[PSERTRANSAM-RXN]]
 +
* [[PSERTRANSAMPYR-RXN]]
 +
* [[PUTTRANSAM-RXN]]
 +
* [[RXN-10721]]
 +
* [[RXN-10814]]
 +
* [[RXN-113]]
 +
* [[RXN-115]]
 +
* [[RXN-11737]]
 +
* [[RXN-13186]]
 +
* [[RXN-13697]]
 +
* [[RXN-13698]]
 +
* [[RXN-14147]]
 +
* [[RXN-14981]]
 +
* [[RXN-15007]]
 +
* [[RXN-171]]
 +
* [[RXN-17679]]
 +
* [[RXN-527]]
 +
* [[RXN-602]]
 +
* [[RXN-6550]]
 +
* [[RXN-7648]]
 +
* [[RXN-7737]]
 +
* [[RXN-7775]]
 +
* [[RXN-7922]]
 +
* [[RXN-8450]]
 +
* [[RXN-8642]]
 +
* [[RXN-8660]]
 +
* [[RXN-8661]]
 +
* [[RXN1F-162]]
 +
* [[RXN1F-163]]
 +
* [[RXN1F-165]]
 +
* [[RXN1F-167]]
 +
* [[RXN1F-168]]
 +
* [[RXN1F-93]]
 +
* [[RXN490-3641]]
 +
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
 +
</div>
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[MONOPHENOL-MONOOXYGENASE-RXN]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
* [[RXN-13061]]
+
* [[2.6.1.22-RXN]]
 +
* [[2.6.1.57-RXN]]
 +
* [[2.6.1.7-RXN]]
 +
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
 +
* [[ACETYLORNTRANSAM-RXN]]
 +
* [[ALANINE-AMINOTRANSFERASE-RXN]]
 +
* [[ASPAMINOTRANS-RXN]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]]
 +
* [[CYSTEINE-AMINOTRANSFERASE-RXN]]
 +
* [[DIAMTRANSAM-RXN]]
 +
* [[GLUTAMATE-DEHYDROGENASE-NADP+-RXN]]
 +
* [[GLUTAMATE-DEHYDROGENASE-RXN]]
 +
* [[GLUTDEHYD-RXN]]
 +
* [[GLYCINE-AMINOTRANSFERASE-RXN]]
 +
* [[HISTAMINOTRANS-RXN]]
 +
* [[ISOCITDEH-RXN]]
 +
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 +
* [[PHEAMINOTRANS-RXN]]
 +
* [[PREPHENATE-TRANSAMINE-RXN]]
 +
* [[PSERTRANSAM-RXN]]
 +
* [[PSERTRANSAMPYR-RXN]]
 +
* [[RXN-10721]]
 +
* [[RXN-10814]]
 +
* [[RXN-11737]]
 +
* [[RXN-12878]]
 +
* [[RXN-13697]]
 +
* [[RXN-13698]]
 +
* [[RXN-14147]]
 +
* [[RXN-15007]]
 +
* [[RXN-17679]]
 +
* [[RXN-7737]]
 +
* [[RXN-8642]]
 +
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=dopaquinone}}
+
{{#set: common-name=2-oxoglutarate}}
−
{{#set: molecular-weight=195.174}}
+
{{#set: molecular-weight=144.084}}
−
{{#set: inchi-key=inchikey=ahmiduvksgchau-lurjtmiesa-n}}
+
{{#set: inchi-key=inchikey=kpgxrsrhynqifn-uhfffaoysa-l}}

Latest revision as of 19:37, 17 March 2021

Metabolite 2-KETOGLUTARATE

  • common-name:
    • 2-oxoglutarate
  • molecular-weight:
    • 144.084
  • inchi-key:
    • kpgxrsrhynqifn-uhfffaoysa-l
  • smiles:
    • c(cc([o-])=o)c(=o)c([o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=2-KETOGLUTARATE&oldid=50306"