Difference between revisions of "2-METHYL-ACETO-ACETYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-seryl-SEC-tRNAs == * common-name: ** an l-seryl-[trnasec] == Reaction(s) known to consume the compound == == Reaction(s) known to produ...")
(Created page with "Category:metabolite == Metabolite 2-METHYL-ACETO-ACETYL-COA == * common-name: ** 2-methylacetoacetyl-coa * molecular-weight: ** 861.604 * inchi-key: ** nhnodhrscralbf-nqnb...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-seryl-SEC-tRNAs ==
+
== Metabolite 2-METHYL-ACETO-ACETYL-COA ==
 
* common-name:
 
* common-name:
** an l-seryl-[trnasec]
+
** 2-methylacetoacetyl-coa
 +
* molecular-weight:
 +
** 861.604
 +
* inchi-key:
 +
** nhnodhrscralbf-nqnbqjknsa-j
 +
* smiles:
 +
** cc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c(=o)c
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1.1.1.178-RXN]]
 +
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-2161]]
+
* [[1.1.1.178-RXN]]
 +
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an l-seryl-[trnasec]}}
+
{{#set: common-name=2-methylacetoacetyl-coa}}
 +
{{#set: molecular-weight=861.604}}
 +
{{#set: inchi-key=inchikey=nhnodhrscralbf-nqnbqjknsa-j}}

Latest revision as of 19:35, 17 March 2021

Metabolite 2-METHYL-ACETO-ACETYL-COA

  • common-name:
    • 2-methylacetoacetyl-coa
  • molecular-weight:
    • 861.604
  • inchi-key:
    • nhnodhrscralbf-nqnbqjknsa-j
  • smiles:
    • cc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c(=o)c

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality