Difference between revisions of "2-hydroxyacyl-glutathiones"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite TMP == * common-name: ** dtmp * molecular-weight: ** 320.195 * inchi-key: ** gyozywvxfndglu-xlpzgreqsa-l * smiles: ** cc1(=cn(c(=o)nc(=o)...")
(Created page with "Category:metabolite == Metabolite CPD1G-768 == * common-name: ** 6-o-α-mycolyl-trehalose 6-phosphate * molecular-weight: ** 1540.305 * inchi-key: ** gxobndajnvberi-b...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite TMP ==
+
== Metabolite CPD1G-768 ==
 
* common-name:
 
* common-name:
** dtmp
+
** 6-o-α-mycolyl-trehalose 6-phosphate
 
* molecular-weight:
 
* molecular-weight:
** 320.195
+
** 1540.305
 
* inchi-key:
 
* inchi-key:
** gyozywvxfndglu-xlpzgreqsa-l
+
** gxobndajnvberi-bgzciimlsa-l
 
* smiles:
 
* smiles:
** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])[o-])o2))
+
** ccccccccccccccccccccccccccc(c(o)cccccccccccccccc2(cc(ccccccccccc1(cc(cccccccccccccccccc)1))2))c(=o)occ3(oc(c(c(c3o)o)o)oc4(c(c(c(c(o4)cop([o-])(=o)[o-])o)o)o))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DTMPKI-RXN]]
+
* [[RXN1G-1435]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-5107]]
 
* [[THYMIDYLATESYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dtmp}}
+
{{#set: common-name=6-o-α-mycolyl-trehalose 6-phosphate}}
{{#set: molecular-weight=320.195}}
+
{{#set: molecular-weight=1540.305}}
{{#set: inchi-key=inchikey=gyozywvxfndglu-xlpzgreqsa-l}}
+
{{#set: inchi-key=inchikey=gxobndajnvberi-bgzciimlsa-l}}

Revision as of 15:05, 15 March 2021

Metabolite CPD1G-768

  • common-name:
    • 6-o-α-mycolyl-trehalose 6-phosphate
  • molecular-weight:
    • 1540.305
  • inchi-key:
    • gxobndajnvberi-bgzciimlsa-l
  • smiles:
    • ccccccccccccccccccccccccccc(c(o)cccccccccccccccc2(cc(ccccccccccc1(cc(cccccccccccccccccc)1))2))c(=o)occ3(oc(c(c(c3o)o)o)oc4(c(c(c(c(o4)cop([o-])(=o)[o-])o)o)o))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality