Difference between revisions of "2-phospho-ligated-tRNA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHORYL-CHOLINE == * common-name: ** phosphocholine * molecular-weight: ** 182.136 * inchi-key: ** yhhsonzfoiemcp-uhfffaoysa-m * smile...")
(Created page with "Category:metabolite == Metabolite 2-phospho-ligated-tRNA == * common_name: ** a 2'-phospho-[ligated trna] == Reaction(s) known to consume the compound == * 2.7.1.160-RXN...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHOSPHORYL-CHOLINE ==
+
== Metabolite 2-phospho-ligated-tRNA ==
* common-name:
+
* common_name:
** phosphocholine
+
** a 2'-phospho-[ligated trna]
* molecular-weight:
 
** 182.136
 
* inchi-key:
 
** yhhsonzfoiemcp-uhfffaoysa-m
 
* smiles:
 
** c[n+](ccop([o-])([o-])=o)(c)c
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.7.15-RXN]]
+
* [[2.7.1.160-RXN]]
* [[RXN-5647]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12056]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phosphocholine}}
+
{{#set: common_name=a 2'-phospho-[ligated trna]}}
{{#set: molecular-weight=182.136}}
 
{{#set: inchi-key=inchikey=yhhsonzfoiemcp-uhfffaoysa-m}}
 

Revision as of 19:03, 17 March 2021

Metabolite 2-phospho-ligated-tRNA

  • common_name:
    • a 2'-phospho-[ligated trna]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common name" (as page type) with input value "a 2'-phospho-[ligated trna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.