Difference between revisions of "23-DIPHOSPHOGLYCERATE"

Revision as of 15:06, 15 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-11529 ==
+== Metabolite GLYCOLALDEHYDE ==
 * common-name:
-** (+)-7-epi-jasmonoyl-coa
+** glycolaldehyde
 * molecular-weight:
-** 955.76
+** 60.052
 * inchi-key:
-** wqkkcppndksaiu-cbgydujusa-j
+** wgcnasohlspbmp-uhfffaoysa-n
 * smiles:
-** ccc=ccc1(c(=o)ccc1cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
+** c(o)[ch]=o
 == Reaction(s) known to consume the compound ==
-* [[RXN-10708]]
+* [[H2NEOPTERINALDOL-RXN]]
+* [[RXN-14023]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-10701]]
+* [[H2NEOPTERINALDOL-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(+)-7-epi-jasmonoyl-coa}}
+{{#set: common-name=glycolaldehyde}}
-{{#set: molecular-weight=955.76}}
+{{#set: molecular-weight=60.052}}
-{{#set: inchi-key=inchikey=wqkkcppndksaiu-cbgydujusa-j}}
+{{#set: inchi-key=inchikey=wgcnasohlspbmp-uhfffaoysa-n}}