Difference between revisions of "23-DIPHOSPHOGLYCERATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11529 == * common-name: ** (+)-7-epi-jasmonoyl-coa * molecular-weight: ** 955.76 * inchi-key: ** wqkkcppndksaiu-cbgydujusa-j * smiles...")
(Created page with "Category:metabolite == Metabolite 23-DIPHOSPHOGLYCERATE == * common-name: ** 2,3-diphospho-d-glycerate * molecular-weight: ** 260.998 * inchi-key: ** xohueycvluuejj-uwtatz...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11529 ==
+
== Metabolite 23-DIPHOSPHOGLYCERATE ==
 
* common-name:
 
* common-name:
** (+)-7-epi-jasmonoyl-coa
+
** 2,3-diphospho-d-glycerate
 
* molecular-weight:
 
* molecular-weight:
** 955.76
+
** 260.998
 
* inchi-key:
 
* inchi-key:
** wqkkcppndksaiu-cbgydujusa-j
+
** xohueycvluuejj-uwtatzphsa-i
 
* smiles:
 
* smiles:
** ccc=ccc1(c(=o)ccc1cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
+
** c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10708]]
+
* [[RXN-15509]]
 +
* [[RXN-15510]]
 +
* [[RXN-15511]]
 +
* [[RXN-15512]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10701]]
+
* [[RXN-15509]]
 +
* [[RXN-15510]]
 +
* [[RXN-15511]]
 +
* [[RXN-15512]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(+)-7-epi-jasmonoyl-coa}}
+
{{#set: common-name=2,3-diphospho-d-glycerate}}
{{#set: molecular-weight=955.76}}
+
{{#set: molecular-weight=260.998}}
{{#set: inchi-key=inchikey=wqkkcppndksaiu-cbgydujusa-j}}
+
{{#set: inchi-key=inchikey=xohueycvluuejj-uwtatzphsa-i}}

Latest revision as of 19:33, 17 March 2021

Metabolite 23-DIPHOSPHOGLYCERATE

  • common-name:
    • 2,3-diphospho-d-glycerate
  • molecular-weight:
    • 260.998
  • inchi-key:
    • xohueycvluuejj-uwtatzphsa-i
  • smiles:
    • c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality