Difference between revisions of "23-DIPHOSPHOGLYCERATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite BETA-ACETYLGLUCOSAMINIDE == * common-name: ** an n-acetyl-β-d-glucosaminyl-r == Reaction(s) known to consume the compound == * 2.4...") |
(Created page with "Category:metabolite == Metabolite 23-DIPHOSPHOGLYCERATE == * common-name: ** 2,3-diphospho-d-glycerate * molecular-weight: ** 260.998 * inchi-key: ** xohueycvluuejj-uwtatz...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 23-DIPHOSPHOGLYCERATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2,3-diphospho-d-glycerate |
| + | * molecular-weight: | ||
| + | ** 260.998 | ||
| + | * inchi-key: | ||
| + | ** xohueycvluuejj-uwtatzphsa-i | ||
| + | * smiles: | ||
| + | ** c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-15509]] |
| + | * [[RXN-15510]] | ||
| + | * [[RXN-15511]] | ||
| + | * [[RXN-15512]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-15509]] | ||
| + | * [[RXN-15510]] | ||
| + | * [[RXN-15511]] | ||
| + | * [[RXN-15512]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2,3-diphospho-d-glycerate}} |
| + | {{#set: molecular-weight=260.998}} | ||
| + | {{#set: inchi-key=inchikey=xohueycvluuejj-uwtatzphsa-i}} | ||
Latest revision as of 19:33, 17 March 2021
Contents
Metabolite 23-DIPHOSPHOGLYCERATE
- common-name:
- 2,3-diphospho-d-glycerate
- molecular-weight:
- 260.998
- inchi-key:
- xohueycvluuejj-uwtatzphsa-i
- smiles:
- c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-]
