Difference between revisions of "23S-rRNA-guanine-1835"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MALTOPENTAOSE == * common-name: ** maltopentaose * molecular-weight: ** 828.725 * inchi-key: ** ftnipwxxignqqf-hzwihctqsa-n * smiles: **...")
(Created page with "Category:metabolite == Metabolite GLC-1-P == * common-name: ** α-d-glucopyranose 1-phosphate * molecular-weight: ** 258.121 * inchi-key: ** hxxfsfrbohsimq-vfuothlcsa...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite MALTOPENTAOSE ==
+
== Metabolite GLC-1-P ==
 
* common-name:
 
* common-name:
−
** maltopentaose
+
** α-d-glucopyranose 1-phosphate
 
* molecular-weight:
 
* molecular-weight:
−
** 828.725
+
** 258.121
 
* inchi-key:
 
* inchi-key:
−
** ftnipwxxignqqf-hzwihctqsa-n
+
** hxxfsfrbohsimq-vfuothlcsa-l
 
* smiles:
 
* smiles:
−
** c(c5(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c(c5o)o)o))o
+
** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[GALACTURIDYLYLTRANS-RXN]]
 +
* [[GLUC1PADENYLTRANS-RXN]]
 +
* [[GLUC1PURIDYLTRANS-RXN]]
 +
* [[GLUCOSE-1-PHOSPHAT-RXN]]
 +
* [[GLUCOSE-16-BISPHOSPHATE-SYNTHASE-RXN]]
 +
* [[PHOSPHOGLUCMUT-RXN]]
 +
* [[RXN-16997]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[GALACTURIDYLYLTRANS-RXN]]
 +
* [[GLUC1PURIDYLTRANS-RXN]]
 +
* [[GLUCOSE-16-BISPHOSPHATE-SYNTHASE-RXN]]
 +
* [[GLYCOPHOSPHORYL-RXN]]
 +
* [[GLYMALTOPHOSPHORYL-RXN]]
 +
* [[PHOSPHOGLUCMUT-RXN]]
 +
* [[RXN-12171]]
 +
* [[RXN-12392]]
 
* [[RXN-14284]]
 
* [[RXN-14284]]
−
== Reaction(s) known to produce the compound ==
 
 
* [[RXN-14285]]
 
* [[RXN-14285]]
 +
* [[RXN-14286]]
 +
* [[RXN-14353]]
 +
* [[RXN-1826]]
 +
* [[RXN-9025]]
 +
* [[RXN0-5182]]
 +
* [[RXN0-5184]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=maltopentaose}}
+
{{#set: common-name=α-d-glucopyranose 1-phosphate}}
−
{{#set: molecular-weight=828.725}}
+
{{#set: molecular-weight=258.121}}
−
{{#set: inchi-key=inchikey=ftnipwxxignqqf-hzwihctqsa-n}}
+
{{#set: inchi-key=inchikey=hxxfsfrbohsimq-vfuothlcsa-l}}

Revision as of 19:01, 17 March 2021

Metabolite GLC-1-P

  • common-name:
    • α-d-glucopyranose 1-phosphate
  • molecular-weight:
    • 258.121
  • inchi-key:
    • hxxfsfrbohsimq-vfuothlcsa-l
  • smiles:
    • c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=23S-rRNA-guanine-1835&oldid=38687"