Difference between revisions of "23S-rRNA-guanine-1835"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MALTOPENTAOSE == * common-name: ** maltopentaose * molecular-weight: ** 828.725 * inchi-key: ** ftnipwxxignqqf-hzwihctqsa-n * smiles: **...")
(Created page with "Category:metabolite == Metabolite 23S-rRNA-guanine-1835 == * common-name: ** a guanine1835 in 23s rrna == Reaction(s) known to consume the compound == * RXN-11635 == R...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MALTOPENTAOSE ==
+
== Metabolite 23S-rRNA-guanine-1835 ==
 
* common-name:
 
* common-name:
** maltopentaose
+
** a guanine1835 in 23s rrna
* molecular-weight:
 
** 828.725
 
* inchi-key:
 
** ftnipwxxignqqf-hzwihctqsa-n
 
* smiles:
 
** c(c5(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c(c5o)o)o))o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14284]]
+
* [[RXN-11635]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14285]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=maltopentaose}}
+
{{#set: common-name=a guanine1835 in 23s rrna}}
{{#set: molecular-weight=828.725}}
 
{{#set: inchi-key=inchikey=ftnipwxxignqqf-hzwihctqsa-n}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite 23S-rRNA-guanine-1835

  • common-name:
    • a guanine1835 in 23s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality