Difference between revisions of "24-2-N-linked-Glycan"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 4-AMINO-BUTYRATE == * common-name: ** 4-aminobutanoate * molecular-weight: ** 103.121 * inchi-key: ** btcsszjgundroe-uhfffaoysa-n * smile...") |
(Created page with "Category:metabolite == Metabolite GLC-6-P == * common-name: ** β-d-glucose 6-phosphate * molecular-weight: ** 258.121 * inchi-key: ** nbschqhzlsjfnq-vfuothlcsa-l * sm...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GLC-6-P == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-d-glucose 6-phosphate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 258.121 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** nbschqhzlsjfnq-vfuothlcsa-l |
* smiles: | * smiles: | ||
| − | ** c(c[ | + | ** c(c1(oc(c(c(c1o)o)o)o))op([o-])([o-])=o |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN66-579]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-d-glucose 6-phosphate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=258.121}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nbschqhzlsjfnq-vfuothlcsa-l}} |
Revision as of 19:02, 17 March 2021
Contents
Metabolite GLC-6-P
- common-name:
- β-d-glucose 6-phosphate
- molecular-weight:
- 258.121
- inchi-key:
- nbschqhzlsjfnq-vfuothlcsa-l
- smiles:
- c(c1(oc(c(c(c1o)o)o)o))op([o-])([o-])=o
