Difference between revisions of "24-26-N-linked-Glycan"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CONIFERYL-ALDEHYDE == * common-name: ** coniferaldehyde * molecular-weight: ** 178.187 * inchi-key: ** dkzbbwmurdfhne-nscuhmnnsa-n * smil...")
(Created page with "Category:metabolite == Metabolite Carboxylic-esters == * common-name: ** a carboxylic ester == Reaction(s) known to consume the compound == * CARBOXYLESTERASE-RXN == R...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CONIFERYL-ALDEHYDE ==
+
== Metabolite Carboxylic-esters ==
 
* common-name:
 
* common-name:
** coniferaldehyde
+
** a carboxylic ester
* molecular-weight:
 
** 178.187
 
* inchi-key:
 
** dkzbbwmurdfhne-nscuhmnnsa-n
 
* smiles:
 
** coc1(=cc(c=cc=o)=cc=c(o)1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[CARBOXYLESTERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1106]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=coniferaldehyde}}
+
{{#set: common-name=a carboxylic ester}}
{{#set: molecular-weight=178.187}}
 
{{#set: inchi-key=inchikey=dkzbbwmurdfhne-nscuhmnnsa-n}}
 

Revision as of 15:06, 15 March 2021

Metabolite Carboxylic-esters

  • common-name:
    • a carboxylic ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality