Difference between revisions of "2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ASN == * common-name: ** l-asparagine * molecular-weight: ** 132.119 * inchi-key: ** dcxyfedjocdnaf-reohclbhsa-n * smiles: ** c(cc(c(=o)[...")
(Created page with "Category:metabolite == Metabolite 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE == * common-name: ** 2-c-methyl-d-erythritol-2,4-cyclodiphosphate * molecular-weight: ** 276.076 *...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite ASN ==
+
== Metabolite 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE ==
 
* common-name:
 
* common-name:
−
** l-asparagine
+
** 2-c-methyl-d-erythritol-2,4-cyclodiphosphate
 
* molecular-weight:
 
* molecular-weight:
−
** 132.119
+
** 276.076
 
* inchi-key:
 
* inchi-key:
−
** dcxyfedjocdnaf-reohclbhsa-n
+
** sfrqrnjmiiuydi-uhnvwzdzsa-l
 
* smiles:
 
* smiles:
−
** c(cc(c(=o)[o-])[n+])(n)=o
+
** cc1(co)(op(=o)([o-])op(=o)([o-])occ(o)1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[ASPARAGHYD-RXN]]
+
* [[RXN0-882]]
−
* [[ASPARAGINE--TRNA-LIGASE-RXN]]
 
−
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[ASNSYNA-RXN]]
+
* [[RXN0-302]]
−
* [[ASNSYNB-RXN]]
 
−
* [[RXN-12460]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=l-asparagine}}
+
{{#set: common-name=2-c-methyl-d-erythritol-2,4-cyclodiphosphate}}
−
{{#set: molecular-weight=132.119}}
+
{{#set: molecular-weight=276.076}}
−
{{#set: inchi-key=inchikey=dcxyfedjocdnaf-reohclbhsa-n}}
+
{{#set: inchi-key=inchikey=sfrqrnjmiiuydi-uhnvwzdzsa-l}}

Latest revision as of 19:37, 17 March 2021

Metabolite 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE

  • common-name:
    • 2-c-methyl-d-erythritol-2,4-cyclodiphosphate
  • molecular-weight:
    • 276.076
  • inchi-key:
    • sfrqrnjmiiuydi-uhnvwzdzsa-l
  • smiles:
    • cc1(co)(op(=o)([o-])op(=o)([o-])occ(o)1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE&oldid=50331"