Difference between revisions of "2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CYS == * common-name: ** l-cysteine * molecular-weight: ** 121.154 * inchi-key: ** xujnekjlayxesh-reohclbhsa-n * smiles: ** c(s)c(c(=o)[o...")
 
(Created page with "Category:metabolite == Metabolite 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE == * common-name: ** 2-c-methyl-d-erythritol-2,4-cyclodiphosphate * molecular-weight: ** 276.076 *...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CYS ==
+
== Metabolite 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE ==
 
* common-name:
 
* common-name:
** l-cysteine
+
** 2-c-methyl-d-erythritol-2,4-cyclodiphosphate
 
* molecular-weight:
 
* molecular-weight:
** 121.154
+
** 276.076
 
* inchi-key:
 
* inchi-key:
** xujnekjlayxesh-reohclbhsa-n
+
** sfrqrnjmiiuydi-uhnvwzdzsa-l
 
* smiles:
 
* smiles:
** c(s)c(c(=o)[o-])[n+]
+
** cc1(co)(op(=o)([o-])op(=o)([o-])occ(o)1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACSERLY-RXN]]
+
* [[RXN0-882]]
* [[CYSPH-RXN]]
 
* [[CYSTATHIONASE-RXN]]
 
* [[CYSTEINE--TRNA-LIGASE-RXN]]
 
* [[CYSTEINE-AMINOTRANSFERASE-RXN]]
 
* [[CYSTEINE-DIOXYGENASE-RXN]]
 
* [[GLUTCYSLIG-RXN]]
 
* [[LCYSDESULF-RXN]]
 
* [[O-SUCCHOMOSERLYASE-RXN]]
 
* [[RXN-12588]]
 
* [[RXN-14385]]
 
* [[RXN-15129]]
 
* [[RXN-15881]]
 
* [[RXN-9787]]
 
* [[RXN0-308]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACSERLY-RXN]]
+
* [[RXN0-302]]
* [[CYSTATHIONASE-RXN]]
 
* [[CYSTEINE-AMINOTRANSFERASE-RXN]]
 
* [[O-SUCCHOMOSERLYASE-RXN]]
 
* [[RXN-14048]]
 
* [[RXN-15130]]
 
* [[RXN-16637]]
 
* [[RXN-6622]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-cysteine}}
+
{{#set: common-name=2-c-methyl-d-erythritol-2,4-cyclodiphosphate}}
{{#set: molecular-weight=121.154}}
+
{{#set: molecular-weight=276.076}}
{{#set: inchi-key=inchikey=xujnekjlayxesh-reohclbhsa-n}}
+
{{#set: inchi-key=inchikey=sfrqrnjmiiuydi-uhnvwzdzsa-l}}

Latest revision as of 19:37, 17 March 2021

Metabolite 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE

  • common-name:
    • 2-c-methyl-d-erythritol-2,4-cyclodiphosphate
  • molecular-weight:
    • 276.076
  • inchi-key:
    • sfrqrnjmiiuydi-uhnvwzdzsa-l
  • smiles:
    • cc1(co)(op(=o)([o-])op(=o)([o-])occ(o)1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality