Difference between revisions of "2Fe-2S-proteins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 7-8-DIHYDROPTEROATE == * common-name: ** 7,8-dihydropteroate * molecular-weight: ** 313.295 * inchi-key: ** wbfyvdchgvnrbh-uhfffaoysa-m *...") |
(Created page with "Category:metabolite == Metabolite DGMP == * common-name: ** dgmp * molecular-weight: ** 345.208 * inchi-key: ** ltfmzdnnppeqng-kvqbguixsa-l * smiles: ** c(op(=o)([o-])[o-]...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DGMP == |
* common-name: | * common-name: | ||
− | ** | + | ** dgmp |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 345.208 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ltfmzdnnppeqng-kvqbguixsa-l |
* smiles: | * smiles: | ||
− | ** c( | + | ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[GMKALT-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN0-385]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=dgmp}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=345.208}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ltfmzdnnppeqng-kvqbguixsa-l}} |
Revision as of 17:52, 13 January 2021
Contents
Metabolite DGMP
- common-name:
- dgmp
- molecular-weight:
- 345.208
- inchi-key:
- ltfmzdnnppeqng-kvqbguixsa-l
- smiles:
- c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))