Difference between revisions of "3-7-DIMETHYLXANTHINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-PHOSPHATIDATE == * common-name: ** a 1,2-diacyl-sn-glycerol 3-phosphate == Reaction(s) known to consume the compound == * CDPDIGLYSYN...") |
(Created page with "Category:metabolite == Metabolite 3-7-DIMETHYLXANTHINE == * common-name: ** theobromine * molecular-weight: ** 180.166 * inchi-key: ** yapqbxqyljrxsa-uhfffaoysa-n * smiles...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-7-DIMETHYLXANTHINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** theobromine |
| + | * molecular-weight: | ||
| + | ** 180.166 | ||
| + | * inchi-key: | ||
| + | ** yapqbxqyljrxsa-uhfffaoysa-n | ||
| + | * smiles: | ||
| + | ** cn2(c=nc1(=c(c(nc(n(c)1)=o)=o)2)) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-11519]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=theobromine}} |
| + | {{#set: molecular-weight=180.166}} | ||
| + | {{#set: inchi-key=inchikey=yapqbxqyljrxsa-uhfffaoysa-n}} | ||
Latest revision as of 19:33, 17 March 2021
Contents
Metabolite 3-7-DIMETHYLXANTHINE
- common-name:
- theobromine
- molecular-weight:
- 180.166
- inchi-key:
- yapqbxqyljrxsa-uhfffaoysa-n
- smiles:
- cn2(c=nc1(=c(c(nc(n(c)1)=o)=o)2))
