Difference between revisions of "3-7-DIMETHYLXANTHINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite AMP == * common-name: ** amp * molecular-weight: ** 345.208 * inchi-key: ** udmbcsslthhncd-kqynxxcusa-l * smiles: ** c(c3(c(c(c(n2(c1(=c(...")
 
(Created page with "Category:metabolite == Metabolite 3-7-DIMETHYLXANTHINE == * common-name: ** theobromine * molecular-weight: ** 180.166 * inchi-key: ** yapqbxqyljrxsa-uhfffaoysa-n * smiles...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite AMP ==
+
== Metabolite 3-7-DIMETHYLXANTHINE ==
 
* common-name:
 
* common-name:
** amp
+
** theobromine
 
* molecular-weight:
 
* molecular-weight:
** 345.208
+
** 180.166
 
* inchi-key:
 
* inchi-key:
** udmbcsslthhncd-kqynxxcusa-l
+
** yapqbxqyljrxsa-uhfffaoysa-n
 
* smiles:
 
* smiles:
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op([o-])([o-])=o
+
** cn2(c=nc1(=c(c(nc(n(c)1)=o)=o)2))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.4.10-RXN]]
+
* [[RXN-11519]]
* [[ADENYL-KIN-RXN]]
 
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
 
* [[AMP-DEAMINASE-RXN]]
 
* [[AMP-DEPHOSPHORYLATION-RXN]]
 
* [[AMPSYN-RXN]]
 
* [[ExchangeSeed-AMP]]
 
* [[PRPPSYN-RXN]]
 
* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
 
* [[RXN-14074]]
 
* [[TransportSeed-AMP]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
* [[2.7.4.10-RXN]]
 
* [[3.1.13.4-RXN]]
 
* [[325-BISPHOSPHATE-NUCLEOTIDASE-RXN]]
 
* [[4-COUMARATE--COA-LIGASE-RXN]]
 
* [[6.2.1.34-RXN]]
 
* [[ACETATE--COA-LIGASE-RXN]]
 
* [[ACYLCOASYN-RXN]]
 
* [[ADENOSINE-KINASE-RXN]]
 
* [[ADENPRIBOSYLTRAN-RXN]]
 
* [[ADENYL-KIN-RXN]]
 
* [[ADENYLYLSULFATASE-RXN]]
 
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
 
* [[ADPSUGPPHOSPHAT-RXN]]
 
* [[ALANINE--TRNA-LIGASE-RXN]]
 
* [[AMPSYN-RXN]]
 
* [[ARGININE--TRNA-LIGASE-RXN]]
 
* [[ARGSUCCINSYN-RXN]]
 
* [[ASNSYNA-RXN]]
 
* [[ASNSYNB-RXN]]
 
* [[ASPARAGINE--TRNA-LIGASE-RXN]]
 
* [[ASPARTATE--TRNA-LIGASE-RXN]]
 
* [[ATP-PYROPHOSPHATASE-RXN]]
 
* [[BIOTINLIG-RXN]]
 
* [[CYSTEINE--TRNA-LIGASE-RXN]]
 
* [[DNA-LIGASE-ATP-RXN]]
 
* [[DNA-LIGASE-NAD+-RXN]]
 
* [[ExchangeSeed-AMP]]
 
* [[GDPPYPHOSKIN-RXN]]
 
* [[GLURS-RXN]]
 
* [[GLUTAMINE--TRNA-LIGASE-RXN]]
 
* [[GLYCINE--TRNA-LIGASE-RXN]]
 
* [[GMP-SYN-GLUT-RXN]]
 
* [[GMP-SYN-NH3-RXN]]
 
* [[GTPPYPHOSKIN-RXN]]
 
* [[H2PTERIDINEPYROPHOSPHOKIN-RXN]]
 
* [[HISTIDINE--TRNA-LIGASE-RXN]]
 
* [[ISOLEUCINE--TRNA-LIGASE-RXN]]
 
* [[LEUCINE--TRNA-LIGASE-RXN]]
 
* [[LINOLENOYL-RXN]]
 
* [[LYSINE--TRNA-LIGASE-RXN]]
 
* [[METHIONINE--TRNA-LIGASE-RXN]]
 
* [[NAD-SYNTH-GLN-RXN]]
 
* [[NAD-SYNTH-NH3-RXN]]
 
* [[NADPYROPHOSPHAT-RXN]]
 
* [[PANTOATE-BETA-ALANINE-LIG-RXN]]
 
* [[PEPSYNTH-RXN]]
 
* [[PHENYLALANINE--TRNA-LIGASE-RXN]]
 
* [[PHYTANATE--COA-LIGASE-RXN]]
 
* [[PROLINE--TRNA-LIGASE-RXN]]
 
* [[PRPPSYN-RXN]]
 
* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
 
* [[R223-RXN]]
 
* [[RNA-LIGASE-ATP-RXN]]
 
* [[RXN-10]]
 
* [[RXN-10862]]
 
* [[RXN-10919]]
 
* [[RXN-1126]]
 
* [[RXN-12056]]
 
* [[RXN-12184]]
 
* [[RXN-12473]]
 
* [[RXN-12978]]
 
* [[RXN-13290]]
 
* [[RXN-13614]]
 
* [[RXN-15733]]
 
* [[RXN-16165]]
 
* [[RXN-16380]]
 
* [[RXN-16389]]
 
* [[RXN-16393]]
 
* [[RXN-16401]]
 
* [[RXN-16402]]
 
* [[RXN-16415]]
 
* [[RXN-16418]]
 
* [[RXN-17155]]
 
* [[RXN-2001]]
 
* [[RXN-7904]]
 
* [[RXN-8348]]
 
* [[RXN-9386]]
 
* [[RXN-9623]]
 
* [[RXN-9644]]
 
* [[RXN-9673]]
 
* [[RXN0-1441]]
 
* [[RXN0-2161]]
 
* [[RXN0-4401]]
 
* [[RXN0-5038]]
 
* [[RXN0-7238]]
 
* [[RXN0-7239]]
 
* [[RXN0-7248]]
 
* [[RXN66-469]]
 
* [[RXN66-474]]
 
* [[RXN66-477]]
 
* [[RXN66-480]]
 
* [[RXN66-483]]
 
* [[RXN66-484]]
 
* [[SERINE--TRNA-LIGASE-RXN]]
 
* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
 
* [[THREONINE--TRNA-LIGASE-RXN]]
 
* [[TRANS-RXN0-623]]
 
* [[TRYPTOPHAN--TRNA-LIGASE-RXN]]
 
* [[TYROSINE--TRNA-LIGASE-RXN]]
 
* [[TransportSeed-AMP]]
 
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 
* [[VALINE--TRNA-LIGASE-RXN]]
 
</div>
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=amp}}
+
{{#set: common-name=theobromine}}
{{#set: molecular-weight=345.208}}
+
{{#set: molecular-weight=180.166}}
{{#set: inchi-key=inchikey=udmbcsslthhncd-kqynxxcusa-l}}
+
{{#set: inchi-key=inchikey=yapqbxqyljrxsa-uhfffaoysa-n}}

Latest revision as of 19:33, 17 March 2021

Metabolite 3-7-DIMETHYLXANTHINE

  • common-name:
    • theobromine
  • molecular-weight:
    • 180.166
  • inchi-key:
    • yapqbxqyljrxsa-uhfffaoysa-n
  • smiles:
    • cn2(c=nc1(=c(c(nc(n(c)1)=o)=o)2))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality