Difference between revisions of "3-CARBOXY-3-HYDROXY-ISOCAPROATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15322 == * common-name: ** l-homophenylalanine * molecular-weight: ** 179.218 * inchi-key: ** jtthkopsmavjfe-vifpvbqesa-n * smiles: *...")
(Created page with "Category:metabolite == Metabolite MALONYL-ACP == * common-name: ** a malonyl-[acp] == Reaction(s) known to consume the compound == <div class="toccolours mw-collapsible mw...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15322 ==
+
== Metabolite MALONYL-ACP ==
 
* common-name:
 
* common-name:
** l-homophenylalanine
+
** a malonyl-[acp]
* molecular-weight:
 
** 179.218
 
* inchi-key:
 
** jtthkopsmavjfe-vifpvbqesa-n
 
* smiles:
 
** c(=o)([o-])c([n+])ccc1(c=cc=cc=1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14467]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[2.3.1.179-RXN]]
 +
* [[2.3.1.41-RXN]]
 +
* [[3-OXOACYL-ACP-SYNTH-BASE-RXN]]
 +
* [[3-OXOACYL-ACP-SYNTH-RXN]]
 +
* [[RXN-10654]]
 +
* [[RXN-10658]]
 +
* [[RXN-11474]]
 +
* [[RXN-11479]]
 +
* [[RXN-14972]]
 +
* [[RXN-16615]]
 +
* [[RXN-16621]]
 +
* [[RXN-16625]]
 +
* [[RXN-16629]]
 +
* [[RXN-8349_PLANTCYC]]
 +
* [[RXN-9516]]
 +
* [[RXN-9523]]
 +
* [[RXN-9527]]
 +
* [[RXN-9531]]
 +
* [[RXN-9535]]
 +
* [[RXN-9539]]
 +
* [[RXN0-2141]]
 +
* [[RXN1G-460]]
 +
* [[RXN3O-1803]]
 +
</div>
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14467]]
+
* [[MALONYL-COA-ACP-TRANSACYL-RXN]]
 +
* [[RXN-8349_PLANTCYC]]
 +
* [[RXN1G-460]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-homophenylalanine}}
+
{{#set: common-name=a malonyl-[acp]}}
{{#set: molecular-weight=179.218}}
 
{{#set: inchi-key=inchikey=jtthkopsmavjfe-vifpvbqesa-n}}
 

Revision as of 18:59, 17 March 2021

Metabolite MALONYL-ACP

  • common-name:
    • a malonyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a malonyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.