Difference between revisions of "3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2105 == * common-name: ** 3-oxododecanoyl-coa * molecular-weight: ** 959.791 * inchi-key: ** hqanbzhvwidnqz-gmhmeamdsa-j * smiles: *...")
 
(Created page with "Category:metabolite == Metabolite HEME_C == * common-name: ** heme c == Reaction(s) known to consume the compound == * HOLOCYTOCHROME-C-SYNTHASE-RXN == Reaction(s) kno...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD0-2105 ==
+
== Metabolite HEME_C ==
 
* common-name:
 
* common-name:
−
** 3-oxododecanoyl-coa
+
** heme c
−
* molecular-weight:
 
−
** 959.791
 
−
* inchi-key:
 
−
** hqanbzhvwidnqz-gmhmeamdsa-j
 
−
* smiles:
 
−
** cccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-14274]]
+
* [[HOLOCYTOCHROME-C-SYNTHASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[HOLOCYTOCHROME-C-SYNTHASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=3-oxododecanoyl-coa}}
+
{{#set: common-name=heme c}}
−
{{#set: molecular-weight=959.791}}
 
−
{{#set: inchi-key=inchikey=hqanbzhvwidnqz-gmhmeamdsa-j}}
 

Revision as of 17:55, 13 January 2021

Metabolite HEME_C

  • common-name:
    • heme c

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P&oldid=18115"