Difference between revisions of "3-ENOLPYRUVYL-SHIKIMATE-5P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8653 == * common-name: ** betanidin * molecular-weight: ** 386.317 * inchi-key: ** xhjkhsxhwjcblx-aaeuagobsa-l * smiles: ** c(=[n+]1(...")
 
(Created page with "Category:metabolite == Metabolite cis-cis-D17-35-3-hydroxyC54-2-ACPs == * common-name: ** a cis,cis-delta17,35-3-hydroxyc54:2-[acp] == Reaction(s) known to consume the com...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8653 ==
+
== Metabolite cis-cis-D17-35-3-hydroxyC54-2-ACPs ==
 
* common-name:
 
* common-name:
** betanidin
+
** a cis,cis-delta17,35-3-hydroxyc54:2-[acp]
* molecular-weight:
 
** 386.317
 
* inchi-key:
 
** xhjkhsxhwjcblx-aaeuagobsa-l
 
* smiles:
 
** c(=[n+]1(c(c([o-])=o)cc2(=c1c=c(o)c(o)=c2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o)c3)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8635]]
+
* [[RXN1G-220]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=betanidin}}
+
{{#set: common-name=a cis,cis-delta17,35-3-hydroxyc54:2-[acp]}}
{{#set: molecular-weight=386.317}}
 
{{#set: inchi-key=inchikey=xhjkhsxhwjcblx-aaeuagobsa-l}}
 

Revision as of 17:51, 13 January 2021

Metabolite cis-cis-D17-35-3-hydroxyC54-2-ACPs

  • common-name:
    • a cis,cis-delta17,35-3-hydroxyc54:2-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a cis,cis-delta17,35-3-hydroxyc54:2-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.