Difference between revisions of "3-HYDROXY-3-METHYL-GLUTARYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11674 == * common-name: ** 5-hydroxytryptophol sulfate * molecular-weight: ** 256.253 * inchi-key: ** focuajyuoxsnds-uhfffaoysa-m * s...")
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-3-METHYL-GLUTARYL-COA == * common-name: ** (s)-3-hydroxy-3-methylglutaryl-coa * molecular-weight: ** 906.621 * inchi-key: ** ca...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-11674 ==
+
== Metabolite 3-HYDROXY-3-METHYL-GLUTARYL-COA ==
 
* common-name:
 
* common-name:
−
** 5-hydroxytryptophol sulfate
+
** (s)-3-hydroxy-3-methylglutaryl-coa
 
* molecular-weight:
 
* molecular-weight:
−
** 256.253
+
** 906.621
 
* inchi-key:
 
* inchi-key:
−
** focuajyuoxsnds-uhfffaoysa-m
+
** cabvtrnmfuvudm-vrhqgpglsa-i
 
* smiles:
 
* smiles:
−
** c(o)cc1(=cnc2(=c1c=c(os(=o)(=o)[o-])c=c2))
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(c)(o)cc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1.1.1.34-RXN]]
 +
* [[HYDROXYMETHYLGLUTARYL-COA-LYASE-RXN]]
 +
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
 +
* [[METHYLGLUTACONYL-COA-HYDRATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-10782]]
+
* [[1.1.1.34-RXN]]
 +
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
 +
* [[METHYLGLUTACONYL-COA-HYDRATASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=5-hydroxytryptophol sulfate}}
+
{{#set: common-name=(s)-3-hydroxy-3-methylglutaryl-coa}}
−
{{#set: molecular-weight=256.253}}
+
{{#set: molecular-weight=906.621}}
−
{{#set: inchi-key=inchikey=focuajyuoxsnds-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=cabvtrnmfuvudm-vrhqgpglsa-i}}

Latest revision as of 19:36, 17 March 2021

Metabolite 3-HYDROXY-3-METHYL-GLUTARYL-COA

  • common-name:
    • (s)-3-hydroxy-3-methylglutaryl-coa
  • molecular-weight:
    • 906.621
  • inchi-key:
    • cabvtrnmfuvudm-vrhqgpglsa-i
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(c)(o)cc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=3-HYDROXY-3-METHYL-GLUTARYL-COA&oldid=50026"