Difference between revisions of "3-HYDROXY-DOCOSAPENTAENOYL-ACP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-20 == * common-name: ** 3-hydroxy-5- oxohexanoyl-coa * molecular-weight: ** 891.63 * inchi-key: ** ltooexbctaxfsu-szrpwbojsa-j * smil...")
 
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-DOCOSAPENTAENOYL-ACP == * common-name: ** a (3r,7z,10z,13z,16z,19z)-3-hydroxydocosa-7,10,13,16,19-pentaenoyl-[acp] == Reaction(...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-20 ==
+
== Metabolite 3-HYDROXY-DOCOSAPENTAENOYL-ACP ==
 
* common-name:
 
* common-name:
** 3-hydroxy-5- oxohexanoyl-coa
+
** a (3r,7z,10z,13z,16z,19z)-3-hydroxydocosa-7,10,13,16,19-pentaenoyl-[acp]
* molecular-weight:
 
** 891.63
 
* inchi-key:
 
** ltooexbctaxfsu-szrpwbojsa-j
 
* smiles:
 
** cc(=o)cc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[R7-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13008]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-hydroxy-5- oxohexanoyl-coa}}
+
{{#set: common-name=a (3r,7z,10z,13z,16z,19z)-3-hydroxydocosa-7,10,13,16,19-pentaenoyl-[acp]}}
{{#set: molecular-weight=891.63}}
 
{{#set: inchi-key=inchikey=ltooexbctaxfsu-szrpwbojsa-j}}
 

Latest revision as of 19:35, 17 March 2021

Metabolite 3-HYDROXY-DOCOSAPENTAENOYL-ACP

  • common-name:
    • a (3r,7z,10z,13z,16z,19z)-3-hydroxydocosa-7,10,13,16,19-pentaenoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (3r,7z,10z,13z,16z,19z)-3-hydroxydocosa-7,10,13,16,19-pentaenoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.