Difference between revisions of "3-HYDROXY-ISOVALERYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MAPKK-Ser-or-Thr-phosphate == * common-name: ** a [map kinase kinase] (l-serine/l-threonine) phosphate == Reaction(s) known to consume th...") |
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-ISOVALERYL-COA == * common-name: ** 3-hydroxyisovaleryl-coa * molecular-weight: ** 863.619 * inchi-key: ** pevzkilcbdeobt-uhfff...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-HYDROXY-ISOVALERYL-COA == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-hydroxyisovaleryl-coa |
| + | * molecular-weight: | ||
| + | ** 863.619 | ||
| + | * inchi-key: | ||
| + | ** pevzkilcbdeobt-uhfffaoysa-j | ||
| + | * smiles: | ||
| + | ** cc(cop(=o)([o-])op(=o)([o-])occ3(c(c(c(n2(c=nc1(c(=nc=nc=12)n)))o3)o)op([o-])([o-])=o))(c)c(c(nccc(nccsc(=o)cc(c)(c)o)=o)=o)o | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-14266]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-14266]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-hydroxyisovaleryl-coa}} |
| + | {{#set: molecular-weight=863.619}} | ||
| + | {{#set: inchi-key=inchikey=pevzkilcbdeobt-uhfffaoysa-j}} | ||
Latest revision as of 19:33, 17 March 2021
Contents
Metabolite 3-HYDROXY-ISOVALERYL-COA
- common-name:
- 3-hydroxyisovaleryl-coa
- molecular-weight:
- 863.619
- inchi-key:
- pevzkilcbdeobt-uhfffaoysa-j
- smiles:
- cc(cop(=o)([o-])op(=o)([o-])occ3(c(c(c(n2(c=nc1(c(=nc=nc=12)n)))o3)o)op([o-])([o-])=o))(c)c(c(nccc(nccsc(=o)cc(c)(c)o)=o)=o)o
