Difference between revisions of "3-HYDROXY-ISOVALERYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GLYCOLLATE == * common-name: ** glycolate * molecular-weight: ** 75.044 * inchi-key: ** aemrfaofkbgasw-uhfffaoysa-m * smiles: ** c(c(=o)[...")
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-ISOVALERYL-COA == * common-name: ** 3-hydroxyisovaleryl-coa * molecular-weight: ** 863.619 * inchi-key: ** pevzkilcbdeobt-uhfff...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GLYCOLLATE ==
+
== Metabolite 3-HYDROXY-ISOVALERYL-COA ==
 
* common-name:
 
* common-name:
** glycolate
+
** 3-hydroxyisovaleryl-coa
 
* molecular-weight:
 
* molecular-weight:
** 75.044
+
** 863.619
 
* inchi-key:
 
* inchi-key:
** aemrfaofkbgasw-uhfffaoysa-m
+
** pevzkilcbdeobt-uhfffaoysa-j
 
* smiles:
 
* smiles:
** c(c(=o)[o-])o
+
** cc(cop(=o)([o-])op(=o)([o-])occ3(c(c(c(n2(c=nc1(c(=nc=nc=12)n)))o3)o)op([o-])([o-])=o))(c)c(c(nccc(nccsc(=o)cc(c)(c)o)=o)=o)o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-969]]
+
* [[RXN-14266]]
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLYOXYLATE-REDUCTASE-NADP+-RXN]]
+
* [[RXN-14266]]
* [[GPH-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=glycolate}}
+
{{#set: common-name=3-hydroxyisovaleryl-coa}}
{{#set: molecular-weight=75.044}}
+
{{#set: molecular-weight=863.619}}
{{#set: inchi-key=inchikey=aemrfaofkbgasw-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=pevzkilcbdeobt-uhfffaoysa-j}}

Latest revision as of 19:33, 17 March 2021

Metabolite 3-HYDROXY-ISOVALERYL-COA

  • common-name:
    • 3-hydroxyisovaleryl-coa
  • molecular-weight:
    • 863.619
  • inchi-key:
    • pevzkilcbdeobt-uhfffaoysa-j
  • smiles:
    • cc(cop(=o)([o-])op(=o)([o-])occ3(c(c(c(n2(c=nc1(c(=nc=nc=12)n)))o3)o)op([o-])([o-])=o))(c)c(c(nccc(nccsc(=o)cc(c)(c)o)=o)=o)o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality