Difference between revisions of "3-KETOACYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19726 == * common-name: ** (4s)-2,3-dehydro-leucocyanidin * molecular-weight: ** 304.256 * inchi-key: ** yaagnrwejszflv-zdusscgksa-n...")
(Created page with "Category:metabolite == Metabolite Odd-Straight-Chain-234-Sat-FA == * common-name: ** an odd numbered straight chain 2,3,4-saturated fatty acid == Reaction(s) known to cons...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19726 ==
+
== Metabolite Odd-Straight-Chain-234-Sat-FA ==
 
* common-name:
 
* common-name:
** (4s)-2,3-dehydro-leucocyanidin
+
** an odd numbered straight chain 2,3,4-saturated fatty acid
* molecular-weight:
 
** 304.256
 
* inchi-key:
 
** yaagnrwejszflv-zdusscgksa-n
 
* smiles:
 
** c3(c(c2(oc1(c=c(c=c(c=1c(c=2o)o)o)o)))=cc(o)=c(c=3)o)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN66-477]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-602]]
+
* [[RXN66-476]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(4s)-2,3-dehydro-leucocyanidin}}
+
{{#set: common-name=an odd numbered straight chain 2,3,4-saturated fatty acid}}
{{#set: molecular-weight=304.256}}
 
{{#set: inchi-key=inchikey=yaagnrwejszflv-zdusscgksa-n}}
 

Revision as of 15:09, 15 March 2021

Metabolite Odd-Straight-Chain-234-Sat-FA

  • common-name:
    • an odd numbered straight chain 2,3,4-saturated fatty acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality