Difference between revisions of "3-METHYLSULFINYLPROPYL-GLUCOSINOLATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TYR == * common-name: ** l-tyrosine * molecular-weight: ** 181.191 * inchi-key: ** ouycccasqsfeme-qmmmgpobsa-n * smiles: ** c(c(cc1(c=cc(...") |
(Created page with "Category:metabolite == Metabolite 3-METHYLSULFINYLPROPYL-GLUCOSINOLATE == * common-name: ** glucoiberin * molecular-weight: ** 422.46 * inchi-key: ** phyyadmvyqursx-wwfizp...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-METHYLSULFINYLPROPYL-GLUCOSINOLATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** glucoiberin |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 422.46 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** phyyadmvyqursx-wwfizpdbsa-m |
* smiles: | * smiles: | ||
| − | ** | + | ** cs(=o)cccc(=nos(=o)(=o)[o-])sc1(oc(co)c(o)c(o)c(o)1) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-2221]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=glucoiberin}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=422.46}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=phyyadmvyqursx-wwfizpdbsa-m}} |
Latest revision as of 19:32, 17 March 2021
Contents
Metabolite 3-METHYLSULFINYLPROPYL-GLUCOSINOLATE
- common-name:
- glucoiberin
- molecular-weight:
- 422.46
- inchi-key:
- phyyadmvyqursx-wwfizpdbsa-m
- smiles:
- cs(=o)cccc(=nos(=o)(=o)[o-])sc1(oc(co)c(o)c(o)c(o)1)
