Difference between revisions of "3-Methyl-Saturated-Fatty-Acyl-CoA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11408 == * common-name: ** triiodothyronine sulfate * molecular-weight: ** 730.028 * inchi-key: ** xbqyqxvjbndcgy-lbprgkrzsa-m * smil...")
(Created page with "Category:metabolite == Metabolite 3-Methyl-Saturated-Fatty-Acyl-CoA == * common-name: ** a 3-methyl-branched 2,3,4-saturated fatty acyl-coa == Reaction(s) known to consume...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-11408 ==
+
== Metabolite 3-Methyl-Saturated-Fatty-Acyl-CoA ==
 
* common-name:
 
* common-name:
−
** triiodothyronine sulfate
+
** a 3-methyl-branched 2,3,4-saturated fatty acyl-coa
−
* molecular-weight:
 
−
** 730.028
 
−
* inchi-key:
 
−
** xbqyqxvjbndcgy-lbprgkrzsa-m
 
−
* smiles:
 
−
** c2(c=c(os(=o)(=o)[o-])c(=cc(oc1(c(=cc(=cc(i)=1)cc(c(=o)[o-])[n+])i))=2)i)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-10615]]
+
* [[RXN66-469]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=triiodothyronine sulfate}}
+
{{#set: common-name=a 3-methyl-branched 2,3,4-saturated fatty acyl-coa}}
−
{{#set: molecular-weight=730.028}}
 
−
{{#set: inchi-key=inchikey=xbqyqxvjbndcgy-lbprgkrzsa-m}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite 3-Methyl-Saturated-Fatty-Acyl-CoA

  • common-name:
    • a 3-methyl-branched 2,3,4-saturated fatty acyl-coa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=3-Methyl-Saturated-Fatty-Acyl-CoA&oldid=50123"