Difference between revisions of "3-OCTAPRENYL-4-HYDROXYBENZOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite EPOXYSQUALENE == * common-name: ** (3s)-2,3-epoxy-2,3-dihydrosqualene * molecular-weight: ** 426.724 * inchi-key: ** qyimspsdbykppy-rskux...")
(Created page with "Category:metabolite == Metabolite CPD0-2106 == * common-name: ** 3-oxooctanoyl-coa * molecular-weight: ** 903.684 * inchi-key: ** wpivbcgrgvnddt-cecatxlmsa-j * smiles: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite EPOXYSQUALENE ==
+
== Metabolite CPD0-2106 ==
 
* common-name:
 
* common-name:
** (3s)-2,3-epoxy-2,3-dihydrosqualene
+
** 3-oxooctanoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 426.724
+
** 903.684
 
* inchi-key:
 
* inchi-key:
** qyimspsdbykppy-rskuxysasa-n
+
** wpivbcgrgvnddt-cecatxlmsa-j
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)cc[ch]1(c(c)(c)o1)
+
** cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CYCLOARTENOL-SYNTHASE-RXN]]
+
* [[RXN-14277]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[SQUALENE-MONOOXYGENASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3s)-2,3-epoxy-2,3-dihydrosqualene}}
+
{{#set: common-name=3-oxooctanoyl-coa}}
{{#set: molecular-weight=426.724}}
+
{{#set: molecular-weight=903.684}}
{{#set: inchi-key=inchikey=qyimspsdbykppy-rskuxysasa-n}}
+
{{#set: inchi-key=inchikey=wpivbcgrgvnddt-cecatxlmsa-j}}

Revision as of 15:12, 15 March 2021

Metabolite CPD0-2106

  • common-name:
    • 3-oxooctanoyl-coa
  • molecular-weight:
    • 903.684
  • inchi-key:
    • wpivbcgrgvnddt-cecatxlmsa-j
  • smiles:
    • cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality