Difference between revisions of "3-OCTAPRENYL-4-HYDROXYBENZOATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2106 == * common-name: ** 3-oxooctanoyl-coa * molecular-weight: ** 903.684 * inchi-key: ** wpivbcgrgvnddt-cecatxlmsa-j * smiles: **...") |
(Created page with "Category:metabolite == Metabolite PYRIDOXINE-5P == * common-name: ** pyridoxine 5'-phosphate * molecular-weight: ** 247.144 * inchi-key: ** whomfkwhiqzthy-uhfffaoysa-l * s...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PYRIDOXINE-5P == |
* common-name: | * common-name: | ||
| − | ** | + | ** pyridoxine 5'-phosphate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 247.144 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** whomfkwhiqzthy-uhfffaoysa-l |
* smiles: | * smiles: | ||
| − | ** | + | ** cc1(=nc=c(cop([o-])(=o)[o-])c(=c(o)1)co) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[PNPOXI-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[PDXJ-RXN]] | ||
| + | * [[PNKIN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=pyridoxine 5'-phosphate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=247.144}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=whomfkwhiqzthy-uhfffaoysa-l}} |
Revision as of 19:03, 17 March 2021
Contents
Metabolite PYRIDOXINE-5P
- common-name:
- pyridoxine 5'-phosphate
- molecular-weight:
- 247.144
- inchi-key:
- whomfkwhiqzthy-uhfffaoysa-l
- smiles:
- cc1(=nc=c(cop([o-])(=o)[o-])c(=c(o)1)co)
