Difference between revisions of "3-OCTAPRENYL-4-HYDROXYBENZOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15366 == * common-name: ** lesqueroloyl-coa * molecular-weight: ** 1072.006 * inchi-key: ** jjyivzkvzzsdmc-gxvfdtdksa-j * smiles: **...")
 
(Created page with "Category:metabolite == Metabolite 3-OCTAPRENYL-4-HYDROXYBENZOATE == * common-name: ** 3-octaprenyl-4-hydroxybenzoate * molecular-weight: ** 682.06 * inchi-key: ** utibhebn...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15366 ==
+
== Metabolite 3-OCTAPRENYL-4-HYDROXYBENZOATE ==
 
* common-name:
 
* common-name:
** lesqueroloyl-coa
+
** 3-octaprenyl-4-hydroxybenzoate
 
* molecular-weight:
 
* molecular-weight:
** 1072.006
+
** 682.06
 
* inchi-key:
 
* inchi-key:
** jjyivzkvzzsdmc-gxvfdtdksa-j
+
** utibhebnildqkx-lqokpsqisa-m
 
* smiles:
 
* smiles:
** ccccccc(o)cc=ccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c)c)c)c
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16152]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=lesqueroloyl-coa}}
+
{{#set: common-name=3-octaprenyl-4-hydroxybenzoate}}
{{#set: molecular-weight=1072.006}}
+
{{#set: molecular-weight=682.06}}
{{#set: inchi-key=inchikey=jjyivzkvzzsdmc-gxvfdtdksa-j}}
+
{{#set: inchi-key=inchikey=utibhebnildqkx-lqokpsqisa-m}}

Latest revision as of 19:37, 17 March 2021

Metabolite 3-OCTAPRENYL-4-HYDROXYBENZOATE

  • common-name:
    • 3-octaprenyl-4-hydroxybenzoate
  • molecular-weight:
    • 682.06
  • inchi-key:
    • utibhebnildqkx-lqokpsqisa-m
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c)c)c)c

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality