Difference between revisions of "3-OXOPIMELOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Unspecified-Degradation-Products == * common-name: ** [unspecified degradation products] == Reaction(s) known to consume the compound ==...")
(Created page with "Category:metabolite == Metabolite CPD-19150 == * common-name: ** (2e,5z)-dodecenoyl-coa * molecular-weight: ** 941.776 * inchi-key: ** zsjrxhrcabosnc-shjpognxsa-j * smiles...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Unspecified-Degradation-Products ==
+
== Metabolite CPD-19150 ==
 
* common-name:
 
* common-name:
** [unspecified degradation products]
+
** (2e,5z)-dodecenoyl-coa
 +
* molecular-weight:
 +
** 941.776
 +
* inchi-key:
 +
** zsjrxhrcabosnc-shjpognxsa-j
 +
* smiles:
 +
** ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17797]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2-NITROPROPANE-DIOXYGENASE-RXN]]
 
* [[RXN-16322]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=[unspecified degradation products]}}
+
{{#set: common-name=(2e,5z)-dodecenoyl-coa}}
 +
{{#set: molecular-weight=941.776}}
 +
{{#set: inchi-key=inchikey=zsjrxhrcabosnc-shjpognxsa-j}}

Revision as of 19:02, 17 March 2021

Metabolite CPD-19150

  • common-name:
    • (2e,5z)-dodecenoyl-coa
  • molecular-weight:
    • 941.776
  • inchi-key:
    • zsjrxhrcabosnc-shjpognxsa-j
  • smiles:
    • ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality