Difference between revisions of "3-Oxo-octanoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GDP-4-DEHYDRO-6-DEOXY-D-MANNOSE == * common-name: ** gdp-4-dehydro-α-d-rhamnose * molecular-weight: ** 585.314 * inchi-key: ** pnhl...")
(Created page with "Category:metabolite == Metabolite MALTOTETRAOSE == * common-name: ** maltotetraose * molecular-weight: ** 666.583 * inchi-key: ** luewuzlmquobsb-ayqjavfrsa-n * smiles: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GDP-4-DEHYDRO-6-DEOXY-D-MANNOSE ==
+
== Metabolite MALTOTETRAOSE ==
 
* common-name:
 
* common-name:
** gdp-4-dehydro-α-d-rhamnose
+
** maltotetraose
 
* molecular-weight:
 
* molecular-weight:
** 585.314
+
** 666.583
 
* inchi-key:
 
* inchi-key:
** pnhlmhwwfopqlk-bkuuwragsa-l
+
** luewuzlmquobsb-ayqjavfrsa-n
 
* smiles:
 
* smiles:
** cc4(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))))c(o)c(o)c(=o)4)
+
** c(c4(oc(oc3(c(oc(oc2(c(oc(oc1(c(oc(o)c(c1o)o)co))c(c2o)o)co))c(c3o)o)co))c(c(o)c4o)o))o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.1.271-RXN]]
+
* [[RXN0-5182]]
* [[GDP-4-DEHYDRO-D-RHAMNOSE-REDUCTASE-RXN]]
 
* [[GDP-6-DEOXY-D-TALOSE-4-DEHYDROGENASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GDPMANDEHYDRA-RXN]]
+
* [[GLYMALTOPHOSPHORYL-RXN]]
 +
* [[RXN-14284]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=gdp-4-dehydro-α-d-rhamnose}}
+
{{#set: common-name=maltotetraose}}
{{#set: molecular-weight=585.314}}
+
{{#set: molecular-weight=666.583}}
{{#set: inchi-key=inchikey=pnhlmhwwfopqlk-bkuuwragsa-l}}
+
{{#set: inchi-key=inchikey=luewuzlmquobsb-ayqjavfrsa-n}}

Revision as of 19:02, 17 March 2021

Metabolite MALTOTETRAOSE

  • common-name:
    • maltotetraose
  • molecular-weight:
    • 666.583
  • inchi-key:
    • luewuzlmquobsb-ayqjavfrsa-n
  • smiles:
    • c(c4(oc(oc3(c(oc(oc2(c(oc(oc1(c(oc(o)c(c1o)o)co))c(c2o)o)co))c(c3o)o)co))c(c(o)c4o)o))o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality