Difference between revisions of "3-P-SERINE"

Revision as of 19:03, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD0-2117 ==
+== Metabolite CPD-316 ==
 * common-name:
-** (2e)-hexadecenoyl-coa
+** reduced riboflavin
 * molecular-weight:
-** 999.899
+** 378.384
 * inchi-key:
-** jupaqfrkphpxld-mshhsvqmsa-j
+** utkdoucgqvljin-pigzvrmjsa-n
 * smiles:
-** cccccccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
+** cc1(=c(c=c2(c(=c1)nc3(c(n2cc(o)c(o)c(o)co)=nc(nc3=o)=o)))c)
 == Reaction(s) known to consume the compound ==
-* [[RXN-14272]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-16540]]
+* [[NADPH-DEHYDROGENASE-FLAVIN-RXN]]
+* [[RXN-12445]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(2e)-hexadecenoyl-coa}}
+{{#set: common-name=reduced riboflavin}}
-{{#set: molecular-weight=999.899}}
+{{#set: molecular-weight=378.384}}
-{{#set: inchi-key=inchikey=jupaqfrkphpxld-mshhsvqmsa-j}}
+{{#set: inchi-key=inchikey=utkdoucgqvljin-pigzvrmjsa-n}}