Difference between revisions of "3-UREIDO-PROPIONATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 4-IMIDAZOLEACETATE == * common-name: ** 4-imidazoleacetate * molecular-weight: ** 125.107 * inchi-key: ** prjknhomhkjcej-uhfffaoysa-m * s...")
(Created page with "Category:metabolite == Metabolite CPD-13713 == * common-name: ** adenosine 5'-phosphoselenate * molecular-weight: ** 473.174 * inchi-key: ** xcadvmzzfpierr-kqynxxcusa-m *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 4-IMIDAZOLEACETATE ==
+
== Metabolite CPD-13713 ==
 
* common-name:
 
* common-name:
** 4-imidazoleacetate
+
** adenosine 5'-phosphoselenate
 
* molecular-weight:
 
* molecular-weight:
** 125.107
+
** 473.174
 
* inchi-key:
 
* inchi-key:
** prjknhomhkjcej-uhfffaoysa-m
+
** xcadvmzzfpierr-kqynxxcusa-m
 
* smiles:
 
* smiles:
** c1(nc=c(cc(=o)[o-])n=1)
+
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(=o)([o-])o[se](=o)(=o)o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10089]]
+
* [[RXN-12720]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-imidazoleacetate}}
+
{{#set: common-name=adenosine 5'-phosphoselenate}}
{{#set: molecular-weight=125.107}}
+
{{#set: molecular-weight=473.174}}
{{#set: inchi-key=inchikey=prjknhomhkjcej-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=xcadvmzzfpierr-kqynxxcusa-m}}

Revision as of 15:08, 15 March 2021

Metabolite CPD-13713

  • common-name:
    • adenosine 5'-phosphoselenate
  • molecular-weight:
    • 473.174
  • inchi-key:
    • xcadvmzzfpierr-kqynxxcusa-m
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(=o)([o-])o[se](=o)(=o)o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality