Difference between revisions of "3-UREIDO-PROPIONATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 4-IMIDAZOLEACETATE == * common-name: ** 4-imidazoleacetate * molecular-weight: ** 125.107 * inchi-key: ** prjknhomhkjcej-uhfffaoysa-m * s...") |
(Created page with "Category:metabolite == Metabolite CPD-13713 == * common-name: ** adenosine 5'-phosphoselenate * molecular-weight: ** 473.174 * inchi-key: ** xcadvmzzfpierr-kqynxxcusa-m *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-13713 == |
* common-name: | * common-name: | ||
− | ** | + | ** adenosine 5'-phosphoselenate |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 473.174 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** xcadvmzzfpierr-kqynxxcusa-m |
* smiles: | * smiles: | ||
− | ** c1( | + | ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(=o)([o-])o[se](=o)(=o)o |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-12720]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=adenosine 5'-phosphoselenate}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=473.174}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xcadvmzzfpierr-kqynxxcusa-m}} |
Revision as of 15:08, 15 March 2021
Contents
Metabolite CPD-13713
- common-name:
- adenosine 5'-phosphoselenate
- molecular-weight:
- 473.174
- inchi-key:
- xcadvmzzfpierr-kqynxxcusa-m
- smiles:
- c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(=o)([o-])o[se](=o)(=o)o