Difference between revisions of "3-UREIDO-PROPIONATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13713 == * common-name: ** adenosine 5'-phosphoselenate * molecular-weight: ** 473.174 * inchi-key: ** xcadvmzzfpierr-kqynxxcusa-m *...")
(Created page with "Category:metabolite == Metabolite SE-2 == * common-name: ** selenide * molecular-weight: ** 78.96 * inchi-key: ** hmubncuqsstaib-uhfffaoysa-n * smiles: ** [se--] == Reacti...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-13713 ==
+
== Metabolite SE-2 ==
 
* common-name:
 
* common-name:
−
** adenosine 5'-phosphoselenate
+
** selenide
 
* molecular-weight:
 
* molecular-weight:
−
** 473.174
+
** 78.96
 
* inchi-key:
 
* inchi-key:
−
** xcadvmzzfpierr-kqynxxcusa-m
+
** hmubncuqsstaib-uhfffaoysa-n
 
* smiles:
 
* smiles:
−
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(=o)([o-])o[se](=o)(=o)o
+
** [se--]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-12720]]
+
* [[SELENOCYSTEINE-LYASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=adenosine 5'-phosphoselenate}}
+
{{#set: common-name=selenide}}
−
{{#set: molecular-weight=473.174}}
+
{{#set: molecular-weight=78.96}}
−
{{#set: inchi-key=inchikey=xcadvmzzfpierr-kqynxxcusa-m}}
+
{{#set: inchi-key=inchikey=hmubncuqsstaib-uhfffaoysa-n}}

Revision as of 19:01, 17 March 2021

Metabolite SE-2

  • common-name:
    • selenide
  • molecular-weight:
    • 78.96
  • inchi-key:
    • hmubncuqsstaib-uhfffaoysa-n
  • smiles:
    • [se--]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=3-UREIDO-PROPIONATE&oldid=38704"