Difference between revisions of "3-UREIDO-PROPIONATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13713 == * common-name: ** adenosine 5'-phosphoselenate * molecular-weight: ** 473.174 * inchi-key: ** xcadvmzzfpierr-kqynxxcusa-m *...")
(Created page with "Category:metabolite == Metabolite 3-UREIDO-PROPIONATE == * common-name: ** 3-ureidopropanoate * molecular-weight: ** 131.111 * inchi-key: ** jsjwchryrhkbbw-uhfffaoysa-m *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13713 ==
+
== Metabolite 3-UREIDO-PROPIONATE ==
 
* common-name:
 
* common-name:
** adenosine 5'-phosphoselenate
+
** 3-ureidopropanoate
 
* molecular-weight:
 
* molecular-weight:
** 473.174
+
** 131.111
 
* inchi-key:
 
* inchi-key:
** xcadvmzzfpierr-kqynxxcusa-m
+
** jsjwchryrhkbbw-uhfffaoysa-m
 
* smiles:
 
* smiles:
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(=o)([o-])o[se](=o)(=o)o
+
** c(nc(=o)n)cc([o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[BETA-UREIDOPROPIONASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12720]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=adenosine 5'-phosphoselenate}}
+
{{#set: common-name=3-ureidopropanoate}}
{{#set: molecular-weight=473.174}}
+
{{#set: molecular-weight=131.111}}
{{#set: inchi-key=inchikey=xcadvmzzfpierr-kqynxxcusa-m}}
+
{{#set: inchi-key=inchikey=jsjwchryrhkbbw-uhfffaoysa-m}}

Latest revision as of 19:34, 17 March 2021

Metabolite 3-UREIDO-PROPIONATE

  • common-name:
    • 3-ureidopropanoate
  • molecular-weight:
    • 131.111
  • inchi-key:
    • jsjwchryrhkbbw-uhfffaoysa-m
  • smiles:
    • c(nc(=o)n)cc([o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality