Difference between revisions of "3-oxo-lignoceroyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18494 == * common-name: ** (6z,9z,12z,15z,18z)-3-oxotetracosapentaenoyl-coa * molecular-weight: ** 1118.034 * inchi-key: ** uiagujimv...")
(Created page with "Category:metabolite == Metabolite L-1-GLYCEROPHOSPHORYLETHANOL-AMINE == * common-name: ** sn-glycero-3-phosphoethanolamine * molecular-weight: ** 215.142 * inchi-key: ** j...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18494 ==
+
== Metabolite L-1-GLYCEROPHOSPHORYLETHANOL-AMINE ==
 
* common-name:
 
* common-name:
** (6z,9z,12z,15z,18z)-3-oxotetracosapentaenoyl-coa
+
** sn-glycero-3-phosphoethanolamine
 
* molecular-weight:
 
* molecular-weight:
** 1118.034
+
** 215.142
 
* inchi-key:
 
* inchi-key:
** uiagujimvqpsdp-qojzhlsosa-j
+
** jznwscpgtdbmew-rxmqykedsa-n
 
* smiles:
 
* smiles:
** cccccc=ccc=ccc=ccc=ccc=cccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** c(op([o-])(occ(co)o)=o)c[n+]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17116]]
+
* [[RXN-14160]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17115]]
+
* [[RXN-15035]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(6z,9z,12z,15z,18z)-3-oxotetracosapentaenoyl-coa}}
+
{{#set: common-name=sn-glycero-3-phosphoethanolamine}}
{{#set: molecular-weight=1118.034}}
+
{{#set: molecular-weight=215.142}}
{{#set: inchi-key=inchikey=uiagujimvqpsdp-qojzhlsosa-j}}
+
{{#set: inchi-key=inchikey=jznwscpgtdbmew-rxmqykedsa-n}}

Revision as of 15:05, 15 March 2021

Metabolite L-1-GLYCEROPHOSPHORYLETHANOL-AMINE

  • common-name:
    • sn-glycero-3-phosphoethanolamine
  • molecular-weight:
    • 215.142
  • inchi-key:
    • jznwscpgtdbmew-rxmqykedsa-n
  • smiles:
    • c(op([o-])(occ(co)o)=o)c[n+]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality