Difference between revisions of "3-oxo-lignoceroyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-1-GLYCEROPHOSPHORYLETHANOL-AMINE == * common-name: ** sn-glycero-3-phosphoethanolamine * molecular-weight: ** 215.142 * inchi-key: ** j...")
(Created page with "Category:metabolite == Metabolite 3-oxo-lignoceroyl-ACPs == * common-name: ** a 3-oxotetracosanoyl-[acp] == Reaction(s) known to consume the compound == * RXN1G-508 ==...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-1-GLYCEROPHOSPHORYLETHANOL-AMINE ==
+
== Metabolite 3-oxo-lignoceroyl-ACPs ==
 
* common-name:
 
* common-name:
** sn-glycero-3-phosphoethanolamine
+
** a 3-oxotetracosanoyl-[acp]
* molecular-weight:
 
** 215.142
 
* inchi-key:
 
** jznwscpgtdbmew-rxmqykedsa-n
 
* smiles:
 
** c(op([o-])(occ(co)o)=o)c[n+]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14160]]
+
* [[RXN1G-508]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15035]]
+
* [[RXN1G-499]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=sn-glycero-3-phosphoethanolamine}}
+
{{#set: common-name=a 3-oxotetracosanoyl-[acp]}}
{{#set: molecular-weight=215.142}}
 
{{#set: inchi-key=inchikey=jznwscpgtdbmew-rxmqykedsa-n}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite 3-oxo-lignoceroyl-ACPs

  • common-name:
    • a 3-oxotetracosanoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 3-oxotetracosanoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.