Difference between revisions of "3-terminal-unsaturated-sugars"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite STEAROYL-COA == * common-name: ** stearoyl-coa * molecular-weight: ** 1029.968 * inchi-key: ** siarjekbadxqjg-lfzquhgesa-j * smiles: ** c...") |
(Created page with "Category:metabolite == Metabolite CH33ADO == * common-name: ** 5'-deoxyadenosine * molecular-weight: ** 251.244 * inchi-key: ** xgyimtfotbmpfp-kqynxxcusa-n * smiles: ** cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CH33ADO == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5'-deoxyadenosine |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 251.244 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xgyimtfotbmpfp-kqynxxcusa-n |
* smiles: | * smiles: | ||
| − | ** | + | ** cc1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[2.8.1.6-RXN]] |
| − | * [[RXN- | + | * [[HEMN-RXN]] |
| − | * [[ | + | * [[RXN-14950]] |
| + | * [[RXN-14957]] | ||
| + | * [[RXN-14959]] | ||
| + | * [[RXN-17472]] | ||
| + | * [[RXN-17473]] | ||
| + | * [[RXN0-949]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5'-deoxyadenosine}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=251.244}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xgyimtfotbmpfp-kqynxxcusa-n}} |
Revision as of 17:58, 13 January 2021
Contents
Metabolite CH33ADO
- common-name:
- 5'-deoxyadenosine
- molecular-weight:
- 251.244
- inchi-key:
- xgyimtfotbmpfp-kqynxxcusa-n
- smiles:
- cc1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)))
