Difference between revisions of "3Prime-OH-Terminated-RNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite IMIDAZOLE-PYRUVATE == * common-name: ** imidazole-pyruvate * molecular-weight: ** 153.117 * inchi-key: ** jejnwereqwmohb-uhfffaoysa-m * s...") |
(Created page with "Category:metabolite == Metabolite ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE == * common-name: ** all-trans-heptaprenyl diphosphate * molecular-weight: ** 651.779 * inchi-key: ** l...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE == |
* common-name: | * common-name: | ||
− | ** | + | ** all-trans-heptaprenyl diphosphate |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 651.779 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** lsjlexwxrktzaj-yuiipxgzsa-k |
* smiles: | * smiles: | ||
− | ** | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-9222]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=all-trans-heptaprenyl diphosphate}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=651.779}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lsjlexwxrktzaj-yuiipxgzsa-k}} |
Revision as of 17:56, 13 January 2021
Contents
Metabolite ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE
- common-name:
- all-trans-heptaprenyl diphosphate
- molecular-weight:
- 651.779
- inchi-key:
- lsjlexwxrktzaj-yuiipxgzsa-k
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]