Difference between revisions of "3Prime-OH-Terminated-RNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite IMIDAZOLE-PYRUVATE == * common-name: ** imidazole-pyruvate * molecular-weight: ** 153.117 * inchi-key: ** jejnwereqwmohb-uhfffaoysa-m * s...")
 
(Created page with "Category:metabolite == Metabolite ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE == * common-name: ** all-trans-heptaprenyl diphosphate * molecular-weight: ** 651.779 * inchi-key: ** l...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite IMIDAZOLE-PYRUVATE ==
+
== Metabolite ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE ==
 
* common-name:
 
* common-name:
** imidazole-pyruvate
+
** all-trans-heptaprenyl diphosphate
 
* molecular-weight:
 
* molecular-weight:
** 153.117
+
** 651.779
 
* inchi-key:
 
* inchi-key:
** jejnwereqwmohb-uhfffaoysa-m
+
** lsjlexwxrktzaj-yuiipxgzsa-k
 
* smiles:
 
* smiles:
** c1(nc=nc(cc(=o)c(=o)[o-])=1)
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7571]]
+
* [[RXN-9222]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7571]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=imidazole-pyruvate}}
+
{{#set: common-name=all-trans-heptaprenyl diphosphate}}
{{#set: molecular-weight=153.117}}
+
{{#set: molecular-weight=651.779}}
{{#set: inchi-key=inchikey=jejnwereqwmohb-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=lsjlexwxrktzaj-yuiipxgzsa-k}}

Revision as of 17:56, 13 January 2021

Metabolite ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE

  • common-name:
    • all-trans-heptaprenyl diphosphate
  • molecular-weight:
    • 651.779
  • inchi-key:
    • lsjlexwxrktzaj-yuiipxgzsa-k
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality