Difference between revisions of "3Prime-OH-Terminated-RNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE == * common-name: ** all-trans-heptaprenyl diphosphate * molecular-weight: ** 651.779 * inchi-key: ** l...")
(Created page with "Category:metabolite == Metabolite Chitodextrins == * common-name: ** a chitodextrin == Reaction(s) known to consume the compound == * RXN-12623 * RXN-12624 == Reac...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE ==
+
== Metabolite Chitodextrins ==
 
* common-name:
 
* common-name:
−
** all-trans-heptaprenyl diphosphate
+
** a chitodextrin
−
* molecular-weight:
 
−
** 651.779
 
−
* inchi-key:
 
−
** lsjlexwxrktzaj-yuiipxgzsa-k
 
−
* smiles:
 
−
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-9222]]
+
* [[RXN-12623]]
 +
* [[RXN-12624]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3.2.1.14-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=all-trans-heptaprenyl diphosphate}}
+
{{#set: common-name=a chitodextrin}}
−
{{#set: molecular-weight=651.779}}
 
−
{{#set: inchi-key=inchikey=lsjlexwxrktzaj-yuiipxgzsa-k}}
 

Revision as of 15:12, 15 March 2021

Metabolite Chitodextrins

  • common-name:
    • a chitodextrin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=3Prime-OH-Terminated-RNAs&oldid=28999"