Difference between revisions of "3b-hydroxy-D5-steroids"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Crotonyl-ACPs == * common-name: ** a (2e)-but-2-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9515 * RXN-9657...") |
(Created page with "Category:metabolite == Metabolite CPD-644 == * common-name: ** l-threo-3-phenylserine * molecular-weight: ** 181.191 * inchi-key: ** vhvgntvusquxps-yumqzzprsa-n * smiles:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-644 == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-threo-3-phenylserine |
| + | * molecular-weight: | ||
| + | ** 181.191 | ||
| + | * inchi-key: | ||
| + | ** vhvgntvusquxps-yumqzzprsa-n | ||
| + | * smiles: | ||
| + | ** c([o-])(=o)c(c(c1(=cc=cc=c1))o)[n+] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[PHENYLSERINE-ALDOLASE-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-threo-3-phenylserine}} |
| + | {{#set: molecular-weight=181.191}} | ||
| + | {{#set: inchi-key=inchikey=vhvgntvusquxps-yumqzzprsa-n}} | ||
Revision as of 15:13, 15 March 2021
Contents
Metabolite CPD-644
- common-name:
- l-threo-3-phenylserine
- molecular-weight:
- 181.191
- inchi-key:
- vhvgntvusquxps-yumqzzprsa-n
- smiles:
- c([o-])(=o)c(c(c1(=cc=cc=c1))o)[n+]
