Difference between revisions of "3b-hydroxy-D5-steroids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-644 == * common-name: ** l-threo-3-phenylserine * molecular-weight: ** 181.191 * inchi-key: ** vhvgntvusquxps-yumqzzprsa-n * smiles:...")
(Created page with "Category:metabolite == Metabolite 3b-hydroxy-D5-steroids == * common-name: ** a 3β-hydroxy-δ5-steroid == Reaction(s) known to consume the compound == * 1.1.1....")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-644 ==
+
== Metabolite 3b-hydroxy-D5-steroids ==
 
* common-name:
 
* common-name:
** l-threo-3-phenylserine
+
** a 3β-hydroxy-δ5-steroid
* molecular-weight:
 
** 181.191
 
* inchi-key:
 
** vhvgntvusquxps-yumqzzprsa-n
 
* smiles:
 
** c([o-])(=o)c(c(c1(=cc=cc=c1))o)[n+]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PHENYLSERINE-ALDOLASE-RXN]]
+
* [[1.1.1.145-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1.1.1.145-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-threo-3-phenylserine}}
+
{{#set: common-name=a 3β-hydroxy-δ5-steroid}}
{{#set: molecular-weight=181.191}}
 
{{#set: inchi-key=inchikey=vhvgntvusquxps-yumqzzprsa-n}}
 

Latest revision as of 19:37, 17 March 2021

Metabolite 3b-hydroxy-D5-steroids

  • common-name:
    • a 3β-hydroxy-δ5-steroid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality