Difference between revisions of "4-CYTIDINE-5-DIPHOSPHO-2-C"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15666 == * common-name: ** 2-trans,6-cis-tridecadienoyl-coa * molecular-weight: ** 955.803 * inchi-key: ** oosdlbaxvxkfib-gtubxknvsa-...")
 
(Created page with "Category:metabolite == Metabolite ACETYL-ACP == * common-name: ** an acetyl-[acp] == Reaction(s) known to consume the compound == * 3-OXOACYL-ACP-SYNTH-BASE-RXN * AC...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-15666 ==
+
== Metabolite ACETYL-ACP ==
 
* common-name:
 
* common-name:
−
** 2-trans,6-cis-tridecadienoyl-coa
+
** an acetyl-[acp]
−
* molecular-weight:
 
−
** 955.803
 
−
* inchi-key:
 
−
** oosdlbaxvxkfib-gtubxknvsa-j
 
−
* smiles:
 
−
** ccccccc=cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3-OXOACYL-ACP-SYNTH-BASE-RXN]]
 +
* [[ACP-S-ACETYLTRANSFER-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-14771]]
+
* [[ACP-S-ACETYLTRANSFER-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=2-trans,6-cis-tridecadienoyl-coa}}
+
{{#set: common-name=an acetyl-[acp]}}
−
{{#set: molecular-weight=955.803}}
 
−
{{#set: inchi-key=inchikey=oosdlbaxvxkfib-gtubxknvsa-j}}
 

Revision as of 17:53, 13 January 2021

Metabolite ACETYL-ACP

  • common-name:
    • an acetyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an acetyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=4-CYTIDINE-5-DIPHOSPHO-2-C&oldid=17595"