Difference between revisions of "4-MALEYL-ACETOACETATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MYRICETIN == * common-name: ** myricetin * molecular-weight: ** 317.231 * inchi-key: ** ikmdfbphznjcsn-uhfffaoysa-m * smiles: ** c1(c(o)=...")
 
(Created page with "Category:metabolite == Metabolite SULFOQUINOVOSYLDIACYLGLYCEROL == * common-name: ** an 6-sulfo-α-d-quinovosyl diacylglycerol == Reaction(s) known to consume the com...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MYRICETIN ==
+
== Metabolite SULFOQUINOVOSYLDIACYLGLYCEROL ==
 
* common-name:
 
* common-name:
** myricetin
+
** an 6-sulfo-α-d-quinovosyl diacylglycerol
* molecular-weight:
 
** 317.231
 
* inchi-key:
 
** ikmdfbphznjcsn-uhfffaoysa-m
 
* smiles:
 
** c1(c(o)=c(o)c(o)=cc=1c2(oc3(c=c(o)c=c(o)c(c(=o)c([o-])=2)=3)))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8450]]
+
* [[RXN-1224]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=myricetin}}
+
{{#set: common-name=an 6-sulfo-α-d-quinovosyl diacylglycerol}}
{{#set: molecular-weight=317.231}}
 
{{#set: inchi-key=inchikey=ikmdfbphznjcsn-uhfffaoysa-m}}
 

Revision as of 17:56, 13 January 2021

Metabolite SULFOQUINOVOSYLDIACYLGLYCEROL

  • common-name:
    • an 6-sulfo-α-d-quinovosyl diacylglycerol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality