Difference between revisions of "4-MALEYL-ACETOACETATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Plastocyanin-Reduced == * common-name: ** a reduced plastocyanin == Reaction(s) known to consume the compound == == Reaction(s) known to...") |
(Created page with "Category:metabolite == Metabolite 4-MALEYL-ACETOACETATE == * common-name: ** 4-maleyl-acetoacetate * molecular-weight: ** 198.132 * inchi-key: ** gacsivhaifqktc-uphrsurjsa...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 4-MALEYL-ACETOACETATE == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-maleyl-acetoacetate |
+ | * molecular-weight: | ||
+ | ** 198.132 | ||
+ | * inchi-key: | ||
+ | ** gacsivhaifqktc-uphrsurjsa-l | ||
+ | * smiles: | ||
+ | ** c([o-])(=o)c=cc(=o)cc(=o)cc([o-])=o | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[HOMOGENTISATE-12-DIOXYGENASE-RXN]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-maleyl-acetoacetate}} |
+ | {{#set: molecular-weight=198.132}} | ||
+ | {{#set: inchi-key=inchikey=gacsivhaifqktc-uphrsurjsa-l}} |
Latest revision as of 19:36, 17 March 2021
Contents
Metabolite 4-MALEYL-ACETOACETATE
- common-name:
- 4-maleyl-acetoacetate
- molecular-weight:
- 198.132
- inchi-key:
- gacsivhaifqktc-uphrsurjsa-l
- smiles:
- c([o-])(=o)c=cc(=o)cc(=o)cc([o-])=o